C22H15N3O2S — CID 141057604
2-(4-nitrophenyl)-4-phenyl-2H-pyrimido[2,1-b][1,3]benzothiazole (PubChem CID 141057604) has the molecular formula C22H15N3O2S and a molecular weight of 385.45 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-4-phenyl-2H-pyrimido[2,1-b][1,3]benzothiazole.
| Compound Name | 2-(4-nitrophenyl)-4-phenyl-2H-pyrimido[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 141057604 |
| Molecular Formula | C22H15N3O2S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-(4-nitrophenyl)-4-phenyl-2H-pyrimido[2,1-b][1,3]benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(C2C=C(c3ccccc3)N3C(=N2)Sc2ccccc23)cc1 |
| InChI | InChI=1S/C22H15N3O2S/c26-25(27)17-12-10-15(11-13-17)18-14-20(16-6-2-1-3-7-16)24-19-8-4-5-9-21(19)28-22(24)23-18/h1-14,18H |
| InChIKey | URXJDGXJEDOKTB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|