About 2-(1H-imidazol-2-yl)-1,8-naphthyridine
2-(1H-imidazol-2-yl)-1,8-naphthyridine (PubChem CID 141064351) has the molecular formula C11H8N4
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-(1H-imidazol-2-yl)-1,8-naphthyridine |
| PubChem CID | 141064351 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-1,8-naphthyridine |
| SMILES | c1cnc2nc(-c3ncc[nH]3)ccc2c1 |
| InChI | InChI=1S/C11H8N4/c1-2-8-3-4-9(11-13-6-7-14-11)15-10(8)12-5-1/h1-7H,(H,13,14) |
| InChIKey | CEYPGZPFRXRHAS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-imidazol-2-yl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazol-2-yl)-1,8-naphthyridine?
The IUPAC name of 2-(1H-imidazol-2-yl)-1,8-naphthyridine (CID 141064351) is 2-(1H-imidazol-2-yl)-1,8-naphthyridine.
What is the SMILES notation for 2-(1H-imidazol-2-yl)-1,8-naphthyridine?
The canonical SMILES for 2-(1H-imidazol-2-yl)-1,8-naphthyridine is c1cnc2nc(-c3ncc[nH]3)ccc2c1.
What is the InChIKey of 2-(1H-imidazol-2-yl)-1,8-naphthyridine?
The InChIKey is CEYPGZPFRXRHAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4/c1-2-8-3-4-9(11-13-6-7-14-11)15-10(8)12-5-1/h1-7H,(H,13,14).
What are the key properties of 2-(1H-imidazol-2-yl)-1,8-naphthyridine?
2-(1H-imidazol-2-yl)-1,8-naphthyridine has a molecular weight of 196.21 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-2-yl)-1,8-naphthyridine is sourced from PubChem (CID 141064351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).