C11H8N4 — CID 141064351
2-(1H-imidazol-2-yl)-1,8-naphthyridine (PubChem CID 141064351) has the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-1,8-naphthyridine.
| Compound Name | 2-(1H-imidazol-2-yl)-1,8-naphthyridine |
|---|---|
| PubChem CID | 141064351 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-1,8-naphthyridine |
| SMILES | c1cnc2nc(-c3ncc[nH]3)ccc2c1 |
| InChI | InChI=1S/C11H8N4/c1-2-8-3-4-9(11-13-6-7-14-11)15-10(8)12-5-1/h1-7H,(H,13,14) |
| InChIKey | CEYPGZPFRXRHAS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |