C10H3F12N — CID 141091771
N,N,2,3-tetrakis(trifluoromethyl)aniline (PubChem CID 141091771) has the molecular formula C10H3F12N and a molecular weight of 365.12 g/mol. Its IUPAC name is N,N,2,3-tetrakis(trifluoromethyl)aniline.
| Compound Name | N,N,2,3-tetrakis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 141091771 |
| Molecular Formula | C10H3F12N |
| Molecular Weight | 365.12 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N,N,2,3-tetrakis(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cccc(N(C(F)(F)F)C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H3F12N/c11-7(12,13)4-2-1-3-5(6(4)8(14,15)16)23(9(17,18)19)10(20,21)22/h1-3H |
| InChIKey | GWRPWCOKONAXES-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.12 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|