C7H7N3OS — CID 141094481
5-methylpyrrolo[3,4-d][1,3]thiazole-2-carboxamide (PubChem CID 141094481) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-methylpyrrolo[3,4-d][1,3]thiazole-2-carboxamide.
| Compound Name | 5-methylpyrrolo[3,4-d][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 141094481 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 5-methylpyrrolo[3,4-d][1,3]thiazole-2-carboxamide |
| SMILES | Cn1cc2nc(C(N)=O)sc2c1 |
| InChI | InChI=1S/C7H7N3OS/c1-10-2-4-5(3-10)12-7(9-4)6(8)11/h2-3H,1H3,(H2,8,11) |
| InChIKey | WSSOCPHLSLEGDK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |