C14H20N2O7S — CID 141109333
[(2R,3R,4R)-5-(5-amino-2H-1,3-thiazol-3-yl)-3,4-bis[(2-deuterioacetyl)oxy]oxolan-2-yl]methyl 2-deuterioacetate (PubChem CID 141109333) has the molecular formula C14H20N2O7S and a molecular weight of 363.41 g/mol. Its IUPAC name is [(2R,3R,4R)-5-(5-amino-2H-1,3-thiazol-3-yl)-3,4-bis[(2-deuterioacetyl)oxy]oxolan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4R)-5-(5-amino-2H-1,3-thiazol-3-yl)-3,4-bis[(2-deuterioacetyl)oxy]oxolan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 141109333 |
| Molecular Formula | C14H20N2O7S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [(2R,3R,4R)-5-(5-amino-2H-1,3-thiazol-3-yl)-3,4-bis[(2-deuterioacetyl)oxy]oxolan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(N2C=C(N)SC2)[C@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C14H20N2O7S/c1-7(17)20-5-10-12(21-8(2)18)13(22-9(3)19)14(23-10)16-4-11(15)24-6-16/h4,10,12-14H,5-6,15H2,1-3H3/t10-,12-,13-,14?/m1/s1/i1D,2D,3D |
| InChIKey | IMPUCCOKVPBUIQ-VRYZBZKESA-N |
| XLogP | -0.10 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|