C15H9F27O3Si3 — CID 141111448
2,4,6-trimethyl-2,4,6-tris(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 141111448) has the molecular formula C15H9F27O3Si3 and a molecular weight of 834.44 g/mol. Its IUPAC name is 2,4,6-trimethyl-2,4,6-tris(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4,6-trimethyl-2,4,6-tris(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 141111448 |
| Molecular Formula | C15H9F27O3Si3 |
| Molecular Weight | 834.44 g/mol |
| Exact Mass | 833.94 |
| IUPAC Name | 2,4,6-trimethyl-2,4,6-tris(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C[Si]1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C15H9F27O3Si3/c1-46(13(37,38)7(22,23)4(16,17)10(28,29)30)43-47(2,14(39,40)8(24,25)5(18,19)11(31,32)33)45-48(3,44-46)15(41,42)9(26,27)6(20,21)12(34,35)36/h1-3H3 |
| InChIKey | CPSZZSLVIXXKJP-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.44 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|