C39H56 — CID 141121439
(1E)-1-[7-(cyclohepten-1-yl)-6-ethynyl-7-hept-1-enylpentadec-8-en-2,4-diyn-6-yl]cyclooctene (PubChem CID 141121439) has the molecular formula C39H56 and a molecular weight of 524.88 g/mol. Its IUPAC name is (1E)-1-[7-(cyclohepten-1-yl)-6-ethynyl-7-hept-1-enylpentadec-8-en-2,4-diyn-6-yl]cyclooctene.
| Compound Name | (1E)-1-[7-(cyclohepten-1-yl)-6-ethynyl-7-hept-1-enylpentadec-8-en-2,4-diyn-6-yl]cyclooctene |
|---|---|
| PubChem CID | 141121439 |
| Molecular Formula | C39H56 |
| Molecular Weight | 524.88 g/mol |
| Exact Mass | 524.44 |
| IUPAC Name | (1E)-1-[7-(cyclohepten-1-yl)-6-ethynyl-7-hept-1-enylpentadec-8-en-2,4-diyn-6-yl]cyclooctene |
| SMILES | C#CC(C#CC#CC)(/C1=C/CCCCCC1)C(C=CCCCCC)(C=CCCCCCC)C1=CCCCCC1 |
| InChI | InChI=1S/C39H56/c1-5-9-12-14-21-28-35-39(34-27-20-13-10-6-2,37-31-24-18-19-25-32-37)38(8-4,33-26-11-7-3)36-29-22-16-15-17-23-30-36/h4,27-29,31,34-35H,5-6,9-10,12-25,30,32H2,1-3H3/b34-27?,35-28?,36-29+ |
| InChIKey | IYZNRFOBRMKFSV-ACCVJWKESA-N |
| XLogP | 11.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.88 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|