C21H34 — CID 162402731
(10S,11S)-10-ethynyl-7,11,15-trimethylhexadeca-1,6,14-triene (PubChem CID 162402731) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is (10S,11S)-10-ethynyl-7,11,15-trimethylhexadeca-1,6,14-triene.
| Compound Name | (10S,11S)-10-ethynyl-7,11,15-trimethylhexadeca-1,6,14-triene |
|---|---|
| PubChem CID | 162402731 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | (10S,11S)-10-ethynyl-7,11,15-trimethylhexadeca-1,6,14-triene |
| SMILES | C#C[C@@H](CCC(C)=CCCCC=C)[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C21H34/c1-7-9-10-11-14-19(5)16-17-21(8-2)20(6)15-12-13-18(3)4/h2,7,13-14,20-21H,1,9-12,15-17H2,3-6H3/t20-,21-/m0/s1 |
| InChIKey | IMNZYVHYVBYTAS-SFTDATJTSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|