C21H19NO6 — CID 141127544
3-methoxy-9-(3,4,5-trimethoxyphenyl)-3H-furo[3,4-b]quinolin-1-one (PubChem CID 141127544) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is 3-methoxy-9-(3,4,5-trimethoxyphenyl)-3H-furo[3,4-b]quinolin-1-one.
| Compound Name | 3-methoxy-9-(3,4,5-trimethoxyphenyl)-3H-furo[3,4-b]quinolin-1-one |
|---|---|
| PubChem CID | 141127544 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-methoxy-9-(3,4,5-trimethoxyphenyl)-3H-furo[3,4-b]quinolin-1-one |
| SMILES | COc1cc(-c2c3c(nc4ccccc24)C(OC)OC3=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H19NO6/c1-24-14-9-11(10-15(25-2)19(14)26-3)16-12-7-5-6-8-13(12)22-18-17(16)20(23)28-21(18)27-4/h5-10,21H,1-4H3 |
| InChIKey | GVYUFOYSDHGICN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |