About cesium 2-fluoroacetate
cesium 2-fluoroacetate (PubChem CID 141149492) has the molecular formula C2H2CsFO2
and a molecular weight of 209.94 g/mol. Its IUPAC name is cesium 2-fluoroacetate.
Molecular Properties
| Compound Name | cesium 2-fluoroacetate |
| PubChem CID | 141149492 |
| Molecular Formula | C2H2CsFO2 |
| Molecular Weight | 209.94 g/mol |
| Exact Mass | 209.91 |
| IUPAC Name | cesium 2-fluoroacetate |
| SMILES | O=C([O-])CF.[Cs+] |
| InChI | InChI=1S/C2H3FO2.Cs/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| InChIKey | HJAPGKKMEVMZJK-UHFFFAOYSA-M |
| XLogP | -4.29 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.94 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cesium 2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium 2-fluoroacetate?
The IUPAC name of cesium 2-fluoroacetate (CID 141149492) is cesium 2-fluoroacetate.
What is the SMILES notation for cesium 2-fluoroacetate?
The canonical SMILES for cesium 2-fluoroacetate is O=C([O-])CF.[Cs+].
What is the InChIKey of cesium 2-fluoroacetate?
The InChIKey is HJAPGKKMEVMZJK-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H3FO2.Cs/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1.
What are the key properties of cesium 2-fluoroacetate?
cesium 2-fluoroacetate has a molecular weight of 209.94 g/mol, XLogP of -4.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium 2-fluoroacetate is sourced from PubChem (CID 141149492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).