C42H40O6 — CID 141151354
benzyl 2,3,4,5-tetraoxo-11-[(4-phenanthren-9-ylphenyl)methyl]tetradecanoate (PubChem CID 141151354) has the molecular formula C42H40O6 and a molecular weight of 640.78 g/mol. Its IUPAC name is benzyl 2,3,4,5-tetraoxo-11-[(4-phenanthren-9-ylphenyl)methyl]tetradecanoate.
| Compound Name | benzyl 2,3,4,5-tetraoxo-11-[(4-phenanthren-9-ylphenyl)methyl]tetradecanoate |
|---|---|
| PubChem CID | 141151354 |
| Molecular Formula | C42H40O6 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | benzyl 2,3,4,5-tetraoxo-11-[(4-phenanthren-9-ylphenyl)methyl]tetradecanoate |
| SMILES | CCCC(CCCCCC(=O)C(=O)C(=O)C(=O)C(=O)OCc1ccccc1)Cc1ccc(-c2cc3ccccc3c3ccccc23)cc1 |
| InChI | InChI=1S/C42H40O6/c1-2-13-29(14-5-4-8-21-38(43)39(44)40(45)41(46)42(47)48-28-31-15-6-3-7-16-31)26-30-22-24-32(25-23-30)37-27-33-17-9-10-18-34(33)35-19-11-12-20-36(35)37/h3,6-7,9-12,15-20,22-25,27,29H,2,4-5,8,13-14,21,26,28H2,1H3 |
| InChIKey | RIVZRKQFLDMQAC-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|