C9H17N3O4S3 — CID 141155245
4-[(2-sulfonyl-1,4-diazepan-1-yl)sulfonyl]thiomorpholine (PubChem CID 141155245) has the molecular formula C9H17N3O4S3 and a molecular weight of 327.45 g/mol. Its IUPAC name is 4-[(2-sulfonyl-1,4-diazepan-1-yl)sulfonyl]thiomorpholine.
| Compound Name | 4-[(2-sulfonyl-1,4-diazepan-1-yl)sulfonyl]thiomorpholine |
|---|---|
| PubChem CID | 141155245 |
| Molecular Formula | C9H17N3O4S3 |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 4-[(2-sulfonyl-1,4-diazepan-1-yl)sulfonyl]thiomorpholine |
| SMILES | O=S(=O)=C1CNCCCN1S(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C9H17N3O4S3/c13-18(14)9-8-10-2-1-3-12(9)19(15,16)11-4-6-17-7-5-11/h10H,1-8H2 |
| InChIKey | SRTOWYZABXTOCQ-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|