C13H16ClNO2 — CID 141159407
3-chloro-1-ethyl-6,7-dimethoxy-3,4-dihydroisoquinoline (PubChem CID 141159407) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 3-chloro-1-ethyl-6,7-dimethoxy-3,4-dihydroisoquinoline.
| Compound Name | 3-chloro-1-ethyl-6,7-dimethoxy-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 141159407 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-chloro-1-ethyl-6,7-dimethoxy-3,4-dihydroisoquinoline |
| SMILES | CCC1=NC(Cl)Cc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C13H16ClNO2/c1-4-10-9-7-12(17-3)11(16-2)5-8(9)6-13(14)15-10/h5,7,13H,4,6H2,1-3H3 |
| InChIKey | ZHZSSTQFVMRRAG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|