C19H30O8 — CID 141165688
tributyl 2-hydroxy-4-oxobut-3-ene-1,2,3-tricarboxylate (PubChem CID 141165688) has the molecular formula C19H30O8 and a molecular weight of 386.44 g/mol. Its IUPAC name is tributyl 2-hydroxy-4-oxobut-3-ene-1,2,3-tricarboxylate.
| Compound Name | tributyl 2-hydroxy-4-oxobut-3-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 141165688 |
| Molecular Formula | C19H30O8 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | tributyl 2-hydroxy-4-oxobut-3-ene-1,2,3-tricarboxylate |
| SMILES | CCCCOC(=O)CC(O)(C(=O)OCCCC)C(=C=O)C(=O)OCCCC |
| InChI | InChI=1S/C19H30O8/c1-4-7-10-25-16(21)13-19(24,18(23)27-12-9-6-3)15(14-20)17(22)26-11-8-5-2/h24H,4-13H2,1-3H3 |
| InChIKey | BUESMCGRVJJACX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|