C9H16O4 — CID 141188993
1-[2-(2-hydroxyethoxy)ethoxy]pent-3-yn-2-ol (PubChem CID 141188993) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethoxy]pent-3-yn-2-ol.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethoxy]pent-3-yn-2-ol |
|---|---|
| PubChem CID | 141188993 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethoxy]pent-3-yn-2-ol |
| SMILES | CC#CC(O)COCCOCCO |
| InChI | InChI=1S/C9H16O4/c1-2-3-9(11)8-13-7-6-12-5-4-10/h9-11H,4-8H2,1H3 |
| InChIKey | YXQIELMYHJUWAS-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|