C17H19ClFN5O2 — CID 141202702
5-chloro-4-N-(2-fluoro-4-morpholin-4-yl-6-prop-2-enoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 141202702) has the molecular formula C17H19ClFN5O2 and a molecular weight of 379.82 g/mol. Its IUPAC name is 5-chloro-4-N-(2-fluoro-4-morpholin-4-yl-6-prop-2-enoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-fluoro-4-morpholin-4-yl-6-prop-2-enoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141202702 |
| Molecular Formula | C17H19ClFN5O2 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 5-chloro-4-N-(2-fluoro-4-morpholin-4-yl-6-prop-2-enoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | C=CCOc1cc(N2CCOCC2)cc(F)c1Nc1nc(N)ncc1Cl |
| InChI | InChI=1S/C17H19ClFN5O2/c1-2-5-26-14-9-11(24-3-6-25-7-4-24)8-13(19)15(14)22-16-12(18)10-21-17(20)23-16/h2,8-10H,1,3-7H2,(H3,20,21,22,23) |
| InChIKey | PQSGRPBGEUUIKR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|