C18H19Br5O2 — CID 141205438
1,3-dibromo-5-(1-bromohexoxy)benzene;3,5-dibromophenol (PubChem CID 141205438) has the molecular formula C18H19Br5O2 and a molecular weight of 666.87 g/mol. Its IUPAC name is 1,3-dibromo-5-(1-bromohexoxy)benzene;3,5-dibromophenol.
| Compound Name | 1,3-dibromo-5-(1-bromohexoxy)benzene;3,5-dibromophenol |
|---|---|
| PubChem CID | 141205438 |
| Molecular Formula | C18H19Br5O2 |
| Molecular Weight | 666.87 g/mol |
| Exact Mass | 661.73 |
| IUPAC Name | 1,3-dibromo-5-(1-bromohexoxy)benzene;3,5-dibromophenol |
| SMILES | CCCCCC(Br)Oc1cc(Br)cc(Br)c1.Oc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C12H15Br3O.C6H4Br2O/c1-2-3-4-5-12(15)16-11-7-9(13)6-10(14)8-11;7-4-1-5(8)3-6(9)2-4/h6-8,12H,2-5H2,1H3;1-3,9H |
| InChIKey | QTCBSBOEKDLYCQ-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.87 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|