C9H14N2 — CID 141207265
2-(2,3-dihydropyrrol-1-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 141207265) has the molecular formula C9H14N2 and a molecular weight of 150.23 g/mol. Its IUPAC name is 2-(2,3-dihydropyrrol-1-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-(2,3-dihydropyrrol-1-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 141207265 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-(2,3-dihydropyrrol-1-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C1=CN(C2CC=CCN2)CC1 |
| InChI | InChI=1S/C9H14N2/c1-2-6-10-9(5-1)11-7-3-4-8-11/h1-3,7,9-10H,4-6,8H2 |
| InChIKey | BUXATVNMNYFKHR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|