About 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin
5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin (PubChem CID 141228722) has the molecular formula C19H34N2O2Sn
and a molecular weight of 441.20 g/mol. Its IUPAC name is 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin.
Molecular Properties
| Compound Name | 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin |
| PubChem CID | 141228722 |
| Molecular Formula | C19H34N2O2Sn |
| Molecular Weight | 441.20 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1cc(OC)nnc1OC |
| InChI | InChI=1S/C13H27.C6H7N2O2.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-9-5-3-4-6(10-2)8-7-5;/h4-12H2,1-3H3;3H,1-2H3; |
| InChIKey | IMSACPQIUFTYAZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.20 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin?
The IUPAC name of 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin (CID 141228722) is 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin.
What is the SMILES notation for 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin?
The canonical SMILES for 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin is CCCCC(CCCC)(CCCC)[Sn]c1cc(OC)nnc1OC.
What is the InChIKey of 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin?
The InChIKey is IMSACPQIUFTYAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27.C6H7N2O2.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-9-5-3-4-6(10-2)8-7-5;/h4-12H2,1-3H3;3H,1-2H3;.
What are the key properties of 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin?
5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin has a molecular weight of 441.20 g/mol, XLogP of 4.55, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylnonan-5-yl-(3,6-dimethoxypyridazin-4-yl)tin is sourced from PubChem (CID 141228722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).