About 3-fluoro-4H-pyrazolo[3,4-b]quinoline
3-fluoro-4H-pyrazolo[3,4-b]quinoline (PubChem CID 141232777) has the molecular formula C10H6FN3
and a molecular weight of 187.18 g/mol. Its IUPAC name is 3-fluoro-4H-pyrazolo[3,4-b]quinoline.
Molecular Properties
| Compound Name | 3-fluoro-4H-pyrazolo[3,4-b]quinoline |
| PubChem CID | 141232777 |
| Molecular Formula | C10H6FN3 |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 3-fluoro-4H-pyrazolo[3,4-b]quinoline |
| SMILES | FC1=C2Cc3ccccc3N=C2N=N1 |
| InChI | InChI=1S/C10H6FN3/c11-9-7-5-6-3-1-2-4-8(6)12-10(7)14-13-9/h1-4H,5H2 |
| InChIKey | AUTSUUKFXIBOCV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4H-pyrazolo[3,4-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4H-pyrazolo[3,4-b]quinoline?
The IUPAC name of 3-fluoro-4H-pyrazolo[3,4-b]quinoline (CID 141232777) is 3-fluoro-4H-pyrazolo[3,4-b]quinoline.
What is the SMILES notation for 3-fluoro-4H-pyrazolo[3,4-b]quinoline?
The canonical SMILES for 3-fluoro-4H-pyrazolo[3,4-b]quinoline is FC1=C2Cc3ccccc3N=C2N=N1.
What is the InChIKey of 3-fluoro-4H-pyrazolo[3,4-b]quinoline?
The InChIKey is AUTSUUKFXIBOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6FN3/c11-9-7-5-6-3-1-2-4-8(6)12-10(7)14-13-9/h1-4H,5H2.
What are the key properties of 3-fluoro-4H-pyrazolo[3,4-b]quinoline?
3-fluoro-4H-pyrazolo[3,4-b]quinoline has a molecular weight of 187.18 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4H-pyrazolo[3,4-b]quinoline is sourced from PubChem (CID 141232777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).