C17H13ClN2O2 — CID 141235687
1'-(4-chlorophenyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 141235687) has the molecular formula C17H13ClN2O2 and a molecular weight of 312.76 g/mol. Its IUPAC name is 1'-(4-chlorophenyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 1'-(4-chlorophenyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 141235687 |
| Molecular Formula | C17H13ClN2O2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 1'-(4-chlorophenyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)C2(CCc3ccccc32)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClN2O2/c18-12-5-7-13(8-6-12)20-16(22)19-15(21)17(20)10-9-11-3-1-2-4-14(11)17/h1-8H,9-10H2,(H,19,21,22) |
| InChIKey | DTWIWVCPZIQWFU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|