C27H23F6IO6S — CID 141255264
[2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-3-iodophenyl]-2-oxoethyl] 4-methylbenzenesulfonate (PubChem CID 141255264) has the molecular formula C27H23F6IO6S and a molecular weight of 716.43 g/mol. Its IUPAC name is [2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-3-iodophenyl]-2-oxoethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-3-iodophenyl]-2-oxoethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 141255264 |
| Molecular Formula | C27H23F6IO6S |
| Molecular Weight | 716.43 g/mol |
| Exact Mass | 716.02 |
| IUPAC Name | [2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-3-iodophenyl]-2-oxoethyl] 4-methylbenzenesulfonate |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccc(C(=O)COS(=O)(=O)c2ccc(C)cc2)cc1I |
| InChI | InChI=1S/C27H23F6IO6S/c1-3-4-18-13-19(25(36,26(28,29)30)27(31,32)33)8-12-23(18)40-24-11-7-17(14-21(24)34)22(35)15-39-41(37,38)20-9-5-16(2)6-10-20/h5-14,36H,3-4,15H2,1-2H3 |
| InChIKey | RHMNCOMYJDJRJJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.43 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|