C18H26N8O2 — CID 141260853
5-[5-[[amino-(2H-azet-1-ylamino)amino]methyl]-4-methoxy-2-propan-2-ylphenoxy]pyrimidine-2,4-diamine (PubChem CID 141260853) has the molecular formula C18H26N8O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 5-[5-[[amino-(2H-azet-1-ylamino)amino]methyl]-4-methoxy-2-propan-2-ylphenoxy]pyrimidine-2,4-diamine.
| Compound Name | 5-[5-[[amino-(2H-azet-1-ylamino)amino]methyl]-4-methoxy-2-propan-2-ylphenoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141260853 |
| Molecular Formula | C18H26N8O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 5-[5-[[amino-(2H-azet-1-ylamino)amino]methyl]-4-methoxy-2-propan-2-ylphenoxy]pyrimidine-2,4-diamine |
| SMILES | COc1cc(C(C)C)c(Oc2cnc(N)nc2N)cc1CN(N)NN1C=CC1 |
| InChI | InChI=1S/C18H26N8O2/c1-11(2)13-8-14(27-3)12(10-26(21)24-25-5-4-6-25)7-15(13)28-16-9-22-18(20)23-17(16)19/h4-5,7-9,11,24H,6,10,21H2,1-3H3,(H4,19,20,22,23) |
| InChIKey | HIIUKSKOOKCVPG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|