C14H22O4 — CID 141267405
2-methyl-6-(3-methylbut-2-enoxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 141267405) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-methyl-6-(3-methylbut-2-enoxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-methyl-6-(3-methylbut-2-enoxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 141267405 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-methyl-6-(3-methylbut-2-enoxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)=CCOC(=O)C1CCCC(C)C1C(=O)O |
| InChI | InChI=1S/C14H22O4/c1-9(2)7-8-18-14(17)11-6-4-5-10(3)12(11)13(15)16/h7,10-12H,4-6,8H2,1-3H3,(H,15,16) |
| InChIKey | SCDPCINUDNLIQR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|