C29H32F2O4 — CID 141274588
3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid (PubChem CID 141274588) has the molecular formula C29H32F2O4 and a molecular weight of 482.57 g/mol. Its IUPAC name is 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid.
| Compound Name | 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 141274588 |
| Molecular Formula | C29H32F2O4 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid |
| SMILES | COCc1cc(OCCCCCCc2ccccc2CCC(=O)O)cc(-c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C29H32F2O4/c1-34-20-21-14-24(25-16-26(30)19-27(31)17-25)18-28(15-21)35-13-7-3-2-4-8-22-9-5-6-10-23(22)11-12-29(32)33/h5-6,9-10,14-19H,2-4,7-8,11-13,20H2,1H3,(H,32,33) |
| InChIKey | WPANJMTYTGDEHP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|