About 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid
3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid (PubChem CID 141274588) has the molecular formula C29H32F2O4
and a molecular weight of 482.57 g/mol. Its IUPAC name is 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid |
| PubChem CID | 141274588 |
| Molecular Formula | C29H32F2O4 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid |
| SMILES | COCc1cc(OCCCCCCc2ccccc2CCC(=O)O)cc(-c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C29H32F2O4/c1-34-20-21-14-24(25-16-26(30)19-27(31)17-25)18-28(15-21)35-13-7-3-2-4-8-22-9-5-6-10-23(22)11-12-29(32)33/h5-6,9-10,14-19H,2-4,7-8,11-13,20H2,1H3,(H,32,33) |
| InChIKey | WPANJMTYTGDEHP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid?
The IUPAC name of 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid (CID 141274588) is 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid.
What is the SMILES notation for 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid?
The canonical SMILES for 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid is COCc1cc(OCCCCCCc2ccccc2CCC(=O)O)cc(-c2cc(F)cc(F)c2)c1.
What is the InChIKey of 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid?
The InChIKey is WPANJMTYTGDEHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32F2O4/c1-34-20-21-14-24(25-16-26(30)19-27(31)17-25)18-28(15-21)35-13-7-3-2-4-8-22-9-5-6-10-23(22)11-12-29(32)33/h5-6,9-10,14-19H,2-4,7-8,11-13,20H2,1H3,(H,32,33).
What are the key properties of 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid?
3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid has a molecular weight of 482.57 g/mol, XLogP of 6.98, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[6-[3-(3,5-difluorophenyl)-5-(methoxymethyl)phenoxy]hexyl]phenyl]propanoic acid is sourced from PubChem (CID 141274588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).