C17H12N4 — CID 141275469
7,8-diphenyl-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 141275469) has the molecular formula C17H12N4 and a molecular weight of 272.31 g/mol. Its IUPAC name is 7,8-diphenyl-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | 7,8-diphenyl-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 141275469 |
| Molecular Formula | C17H12N4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 7,8-diphenyl-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | c1ccc(-c2ncn3cnnc3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H12N4/c1-3-7-13(8-4-1)15-16(14-9-5-2-6-10-14)18-11-21-12-19-20-17(15)21/h1-12H |
| InChIKey | QTXHNIORIGKXMA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |