C17H16FNO5S — CID 141300157
ethyl 2-[3-[(4-fluorophenyl)sulfonylamino]phenyl]-3-oxopropanoate (PubChem CID 141300157) has the molecular formula C17H16FNO5S and a molecular weight of 365.38 g/mol. Its IUPAC name is ethyl 2-[3-[(4-fluorophenyl)sulfonylamino]phenyl]-3-oxopropanoate.
| Compound Name | ethyl 2-[3-[(4-fluorophenyl)sulfonylamino]phenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 141300157 |
| Molecular Formula | C17H16FNO5S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | ethyl 2-[3-[(4-fluorophenyl)sulfonylamino]phenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(C=O)c1cccc(NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H16FNO5S/c1-2-24-17(21)16(11-20)12-4-3-5-14(10-12)19-25(22,23)15-8-6-13(18)7-9-15/h3-11,16,19H,2H2,1H3 |
| InChIKey | NZWVPXROVKSGMU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|