C20H25FO — CID 141312025
2-fluoro-6-phenyl-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 141312025) has the molecular formula C20H25FO and a molecular weight of 300.42 g/mol. Its IUPAC name is 2-fluoro-6-phenyl-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-fluoro-6-phenyl-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 141312025 |
| Molecular Formula | C20H25FO |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 2-fluoro-6-phenyl-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1cc(F)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H25FO/c1-19(2,3)13-20(4,5)15-11-16(18(22)17(21)12-15)14-9-7-6-8-10-14/h6-12,22H,13H2,1-5H3 |
| InChIKey | HNKYVRUWHVIXRI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |