C13H13IN2 — CID 141320938
3-iodo-6-pentylbenzene-1,2-dicarbonitrile (PubChem CID 141320938) has the molecular formula C13H13IN2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 3-iodo-6-pentylbenzene-1,2-dicarbonitrile.
| Compound Name | 3-iodo-6-pentylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 141320938 |
| Molecular Formula | C13H13IN2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 3-iodo-6-pentylbenzene-1,2-dicarbonitrile |
| SMILES | CCCCCc1ccc(I)c(C#N)c1C#N |
| InChI | InChI=1S/C13H13IN2/c1-2-3-4-5-10-6-7-13(14)12(9-16)11(10)8-15/h6-7H,2-5H2,1H3 |
| InChIKey | MYIHDHPCJHDLQA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|