C21H22N2O — CID 14365779
3-[2-(4-hydroxyphenyl)ethyl]-6-pentylbenzene-1,2-dicarbonitrile (PubChem CID 14365779) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-[2-(4-hydroxyphenyl)ethyl]-6-pentylbenzene-1,2-dicarbonitrile.
| Compound Name | 3-[2-(4-hydroxyphenyl)ethyl]-6-pentylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 14365779 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-[2-(4-hydroxyphenyl)ethyl]-6-pentylbenzene-1,2-dicarbonitrile |
| SMILES | CCCCCc1ccc(CCc2ccc(O)cc2)c(C#N)c1C#N |
| InChI | InChI=1S/C21H22N2O/c1-2-3-4-5-17-10-11-18(21(15-23)20(17)14-22)9-6-16-7-12-19(24)13-8-16/h7-8,10-13,24H,2-6,9H2,1H3 |
| InChIKey | JZOJCWYAMQIMJI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|