C34H28N6 — CID 141320943
3-[2-[2,3-dicyano-4-(3,4-dicyanopentan-2-yl)phenyl]phenyl]-6-pentylbenzene-1,2-dicarbonitrile (PubChem CID 141320943) has the molecular formula C34H28N6 and a molecular weight of 520.64 g/mol. Its IUPAC name is 3-[2-[2,3-dicyano-4-(3,4-dicyanopentan-2-yl)phenyl]phenyl]-6-pentylbenzene-1,2-dicarbonitrile.
| Compound Name | 3-[2-[2,3-dicyano-4-(3,4-dicyanopentan-2-yl)phenyl]phenyl]-6-pentylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 141320943 |
| Molecular Formula | C34H28N6 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 3-[2-[2,3-dicyano-4-(3,4-dicyanopentan-2-yl)phenyl]phenyl]-6-pentylbenzene-1,2-dicarbonitrile |
| SMILES | CCCCCc1ccc(-c2ccccc2-c2ccc(C(C)C(C#N)C(C)C#N)c(C#N)c2C#N)c(C#N)c1C#N |
| InChI | InChI=1S/C34H28N6/c1-4-5-6-9-24-12-13-28(33(20-39)31(24)18-37)26-10-7-8-11-27(26)29-15-14-25(32(19-38)34(29)21-40)23(3)30(17-36)22(2)16-35/h7-8,10-15,22-23,30H,4-6,9H2,1-3H3 |
| InChIKey | UEOCFPHGVHUDPD-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|