About 3-iodo-6-phenylbenzene-1,2-dicarbonitrile
3-iodo-6-phenylbenzene-1,2-dicarbonitrile (PubChem CID 141320941) has the molecular formula C14H7IN2
and a molecular weight of 330.13 g/mol. Its IUPAC name is 3-iodo-6-phenylbenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3-iodo-6-phenylbenzene-1,2-dicarbonitrile |
| PubChem CID | 141320941 |
| Molecular Formula | C14H7IN2 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 3-iodo-6-phenylbenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(I)ccc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C14H7IN2/c15-14-7-6-11(10-4-2-1-3-5-10)12(8-16)13(14)9-17/h1-7H |
| InChIKey | IAOXKVIXUMNSFX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-6-phenylbenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-6-phenylbenzene-1,2-dicarbonitrile?
The IUPAC name of 3-iodo-6-phenylbenzene-1,2-dicarbonitrile (CID 141320941) is 3-iodo-6-phenylbenzene-1,2-dicarbonitrile.
What is the SMILES notation for 3-iodo-6-phenylbenzene-1,2-dicarbonitrile?
The canonical SMILES for 3-iodo-6-phenylbenzene-1,2-dicarbonitrile is N#Cc1c(I)ccc(-c2ccccc2)c1C#N.
What is the InChIKey of 3-iodo-6-phenylbenzene-1,2-dicarbonitrile?
The InChIKey is IAOXKVIXUMNSFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7IN2/c15-14-7-6-11(10-4-2-1-3-5-10)12(8-16)13(14)9-17/h1-7H.
What are the key properties of 3-iodo-6-phenylbenzene-1,2-dicarbonitrile?
3-iodo-6-phenylbenzene-1,2-dicarbonitrile has a molecular weight of 330.13 g/mol, XLogP of 3.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-6-phenylbenzene-1,2-dicarbonitrile is sourced from PubChem (CID 141320941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).