C3H10O11P2 — CID 141324558
(1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid (PubChem CID 141324558) has the molecular formula C3H10O11P2 and a molecular weight of 284.05 g/mol. Its IUPAC name is (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid.
| Compound Name | (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid |
|---|---|
| PubChem CID | 141324558 |
| Molecular Formula | C3H10O11P2 |
| Molecular Weight | 284.05 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid |
| SMILES | O=CC(O)C(O)OP(=O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C3H7O7P.H3O4P/c4-1-2(5)3(6)10-11(7,8)9;1-5(2,3)4/h1-3,5-6H,(H2,7,8,9);(H3,1,2,3,4) |
| InChIKey | HIYYMVFQQMPEMU-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 202.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.05 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|