(1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid

C3H10O11P2 — CID 141324558

IUPAC(1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid
SMILESO=CC(O)C(O)OP(=O)(O)O.O=P(O)(O)O
InChIInChI=1S/C3H7O7P.H3O4P/c4-1-2(5)3(6)10-11(7,8)9;1-5(2,3)4/h1-3,5-6H,(H2,7,8,9);(H3,1,2,3,4)
InChIKeyHIYYMVFQQMPEMU-UHFFFAOYSA-N
MW284.05 g/mol
LogP-2.95
Rot. Bonds4

About (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid

(1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid (PubChem CID 141324558) has the molecular formula C3H10O11P2 and a molecular weight of 284.05 g/mol. Its IUPAC name is (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid.

Molecular Properties

Compound Name(1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid
PubChem CID141324558
Molecular FormulaC3H10O11P2
Molecular Weight284.05 g/mol
Exact Mass283.97
IUPAC Name(1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid
SMILESO=CC(O)C(O)OP(=O)(O)O.O=P(O)(O)O
InChIInChI=1S/C3H7O7P.H3O4P/c4-1-2(5)3(6)10-11(7,8)9;1-5(2,3)4/h1-3,5-6H,(H2,7,8,9);(H3,1,2,3,4)
InChIKeyHIYYMVFQQMPEMU-UHFFFAOYSA-N
XLogP-2.95
TPSA202.05 Ų
H-Bond Donors7
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500284.05
LogP ≤ 5-2.95
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid?
The IUPAC name of (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid (CID 141324558) is (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid.
What is the SMILES notation for (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid?
The canonical SMILES for (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid is O=CC(O)C(O)OP(=O)(O)O.O=P(O)(O)O.
What is the InChIKey of (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid?
The InChIKey is HIYYMVFQQMPEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O7P.H3O4P/c4-1-2(5)3(6)10-11(7,8)9;1-5(2,3)4/h1-3,5-6H,(H2,7,8,9);(H3,1,2,3,4).
What are the key properties of (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid?
(1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid has a molecular weight of 284.05 g/mol, XLogP of -2.95, 4 rotatable bonds, 7 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dihydroxy-3-oxopropyl) dihydrogen phosphate;phosphoric acid is sourced from PubChem (CID 141324558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).