C8H9BO4 — CID 141325140
(2,3-dihydroxyphenoxy)-ethenylborinic acid (PubChem CID 141325140) has the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. Its IUPAC name is (2,3-dihydroxyphenoxy)-ethenylborinic acid.
| Compound Name | (2,3-dihydroxyphenoxy)-ethenylborinic acid |
|---|---|
| PubChem CID | 141325140 |
| Molecular Formula | C8H9BO4 |
| Molecular Weight | 179.97 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (2,3-dihydroxyphenoxy)-ethenylborinic acid |
| SMILES | C=CB(O)Oc1cccc(O)c1O |
| InChI | InChI=1S/C8H9BO4/c1-2-9(12)13-7-5-3-4-6(10)8(7)11/h2-5,10-12H,1H2 |
| InChIKey | ROOKKUURSTWOQZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.97 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|