C36H30N3O18P3 — CID 154420652
3-[[2,4,4,6,6-pentakis(2,3-dihydroxyphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]benzene-1,2-diol (PubChem CID 154420652) has the molecular formula C36H30N3O18P3 and a molecular weight of 885.56 g/mol. Its IUPAC name is 3-[[2,4,4,6,6-pentakis(2,3-dihydroxyphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]benzene-1,2-diol.
| Compound Name | 3-[[2,4,4,6,6-pentakis(2,3-dihydroxyphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]benzene-1,2-diol |
|---|---|
| PubChem CID | 154420652 |
| Molecular Formula | C36H30N3O18P3 |
| Molecular Weight | 885.56 g/mol |
| Exact Mass | 885.07 |
| IUPAC Name | 3-[[2,4,4,6,6-pentakis(2,3-dihydroxyphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]benzene-1,2-diol |
| SMILES | Oc1cccc(OP2(Oc3cccc(O)c3O)=NP(Oc3cccc(O)c3O)(Oc3cccc(O)c3O)=NP(Oc3cccc(O)c3O)(Oc3cccc(O)c3O)=N2)c1O |
| InChI | InChI=1S/C36H30N3O18P3/c40-19-7-1-13-25(31(19)46)52-58(53-26-14-2-8-20(41)32(26)47)37-59(54-27-15-3-9-21(42)33(27)48,55-28-16-4-10-22(43)34(28)49)39-60(38-58,56-29-17-5-11-23(44)35(29)50)57-30-18-6-12-24(45)36(30)51/h1-18,40-51H |
| InChIKey | XQSKWEWUOFKAGE-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 335.22 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.56 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|