C22H34N5O9P — CID 141375706
2-[[(2S,5R)-5-(6-acetyloxy-2-aminopurin-9-yl)oxolan-2-yl]methoxy-(2,2-dimethylpropoxy)phosphoryl]oxyethyl propanoate (PubChem CID 141375706) has the molecular formula C22H34N5O9P and a molecular weight of 543.51 g/mol. Its IUPAC name is 2-[[(2S,5R)-5-(6-acetyloxy-2-aminopurin-9-yl)oxolan-2-yl]methoxy-(2,2-dimethylpropoxy)phosphoryl]oxyethyl propanoate.
| Compound Name | 2-[[(2S,5R)-5-(6-acetyloxy-2-aminopurin-9-yl)oxolan-2-yl]methoxy-(2,2-dimethylpropoxy)phosphoryl]oxyethyl propanoate |
|---|---|
| PubChem CID | 141375706 |
| Molecular Formula | C22H34N5O9P |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 2-[[(2S,5R)-5-(6-acetyloxy-2-aminopurin-9-yl)oxolan-2-yl]methoxy-(2,2-dimethylpropoxy)phosphoryl]oxyethyl propanoate |
| SMILES | CCC(=O)OCCOP(=O)(OC[C@@H]1CC[C@H](n2cnc3c(OC(C)=O)nc(N)nc32)O1)OCC(C)(C)C |
| InChI | InChI=1S/C22H34N5O9P/c1-6-17(29)31-9-10-32-37(30,34-12-22(3,4)5)33-11-15-7-8-16(36-15)27-13-24-18-19(27)25-21(23)26-20(18)35-14(2)28/h13,15-16H,6-12H2,1-5H3,(H2,23,25,26)/t15-,16+,37?/m0/s1 |
| InChIKey | KOBFBRJWGILADP-WQTUIJLWSA-N |
| XLogP | 3.17 |
| TPSA | 176.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|