C24H22ClNO2 — CID 141380691
9H-fluoren-9-ylmethyl N-(3-chloro-2,3,7,7a-tetrahydro-1H-inden-5-yl)carbamate (PubChem CID 141380691) has the molecular formula C24H22ClNO2 and a molecular weight of 391.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(3-chloro-2,3,7,7a-tetrahydro-1H-inden-5-yl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(3-chloro-2,3,7,7a-tetrahydro-1H-inden-5-yl)carbamate |
|---|---|
| PubChem CID | 141380691 |
| Molecular Formula | C24H22ClNO2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(3-chloro-2,3,7,7a-tetrahydro-1H-inden-5-yl)carbamate |
| SMILES | O=C(NC1=CCC2CCC(Cl)C2=C1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H22ClNO2/c25-23-12-10-15-9-11-16(13-21(15)23)26-24(27)28-14-22-19-7-3-1-5-17(19)18-6-2-4-8-20(18)22/h1-8,11,13,15,22-23H,9-10,12,14H2,(H,26,27) |
| InChIKey | CGRCILLIAHCYND-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|