C17H26O3S — CID 141410423
2-[(3,5-ditert-butylphenyl)-hydroxymethyl]sulfanylacetic acid (PubChem CID 141410423) has the molecular formula C17H26O3S and a molecular weight of 310.46 g/mol. Its IUPAC name is 2-[(3,5-ditert-butylphenyl)-hydroxymethyl]sulfanylacetic acid.
| Compound Name | 2-[(3,5-ditert-butylphenyl)-hydroxymethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 141410423 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-[(3,5-ditert-butylphenyl)-hydroxymethyl]sulfanylacetic acid |
| SMILES | CC(C)(C)c1cc(C(O)SCC(=O)O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26O3S/c1-16(2,3)12-7-11(15(20)21-10-14(18)19)8-13(9-12)17(4,5)6/h7-9,15,20H,10H2,1-6H3,(H,18,19) |
| InChIKey | ZLOPJZXKIWJWGH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|