C13H20 — CID 141412995
4,5-dimethyltricyclo[6.2.1.02,7]undec-2(7)-ene (PubChem CID 141412995) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 4,5-dimethyltricyclo[6.2.1.02,7]undec-2(7)-ene.
| Compound Name | 4,5-dimethyltricyclo[6.2.1.02,7]undec-2(7)-ene |
|---|---|
| PubChem CID | 141412995 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 4,5-dimethyltricyclo[6.2.1.02,7]undec-2(7)-ene |
| SMILES | CC1CC2=C(CC1C)C1CCC2C1 |
| InChI | InChI=1S/C13H20/c1-8-5-12-10-3-4-11(7-10)13(12)6-9(8)2/h8-11H,3-7H2,1-2H3 |
| InChIKey | FNKLZROEUYFFOM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|