C22H42N2O3 — CID 141435056
2,2,6,6-tetramethyl-1-[(Z)-2-nitrotridec-2-enoxy]piperidine (PubChem CID 141435056) has the molecular formula C22H42N2O3 and a molecular weight of 382.59 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[(Z)-2-nitrotridec-2-enoxy]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-[(Z)-2-nitrotridec-2-enoxy]piperidine |
|---|---|
| PubChem CID | 141435056 |
| Molecular Formula | C22H42N2O3 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.32 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[(Z)-2-nitrotridec-2-enoxy]piperidine |
| SMILES | CCCCCCCCCC/C=C(/CON1C(C)(C)CCCC1(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C22H42N2O3/c1-6-7-8-9-10-11-12-13-14-16-20(23(25)26)19-27-24-21(2,3)17-15-18-22(24,4)5/h16H,6-15,17-19H2,1-5H3/b20-16- |
| InChIKey | GPMINLSWXCSKKT-SILNSSARSA-N |
| XLogP | 6.65 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|