C18H12F4N2O5S — CID 141438767
N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[3-(4-fluorophenyl)sulfanyldioxiran-3-yl]-N,2-dihydroxypropanamide (PubChem CID 141438767) has the molecular formula C18H12F4N2O5S and a molecular weight of 444.36 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[3-(4-fluorophenyl)sulfanyldioxiran-3-yl]-N,2-dihydroxypropanamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[3-(4-fluorophenyl)sulfanyldioxiran-3-yl]-N,2-dihydroxypropanamide |
|---|---|
| PubChem CID | 141438767 |
| Molecular Formula | C18H12F4N2O5S |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[3-(4-fluorophenyl)sulfanyldioxiran-3-yl]-N,2-dihydroxypropanamide |
| SMILES | CC(O)(C(=O)N(O)c1ccc(C#N)c(C(F)(F)F)c1)C1(Sc2ccc(F)cc2)OO1 |
| InChI | InChI=1S/C18H12F4N2O5S/c1-16(26,18(28-29-18)30-13-6-3-11(19)4-7-13)15(25)24(27)12-5-2-10(9-23)14(8-12)17(20,21)22/h2-8,26-27H,1H3 |
| InChIKey | SJKVXSCJWGJNHM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|