C29H55N4O6S+ — CID 141453444
tributyl-[1-[[(2S,5R)-2-(cyclohexyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]oxysulfonyl]butyl]azanium (PubChem CID 141453444) has the molecular formula C29H55N4O6S+ and a molecular weight of 587.85 g/mol. Its IUPAC name is tributyl-[1-[[(2S,5R)-2-(cyclohexyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]oxysulfonyl]butyl]azanium.
| Compound Name | tributyl-[1-[[(2S,5R)-2-(cyclohexyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]oxysulfonyl]butyl]azanium |
|---|---|
| PubChem CID | 141453444 |
| Molecular Formula | C29H55N4O6S+ |
| Molecular Weight | 587.85 g/mol |
| Exact Mass | 587.38 |
| IUPAC Name | tributyl-[1-[[(2S,5R)-2-(cyclohexyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl]oxysulfonyl]butyl]azanium |
| SMILES | CCCC[N+](CCCC)(CCCC)C(CCC)S(=O)(=O)ON1C(=O)N2C[C@H]1CC[C@H]2C(=O)NOC1CCCCC1 |
| InChI | InChI=1S/C29H54N4O6S/c1-5-9-20-33(21-10-6-2,22-11-7-3)27(15-8-4)40(36,37)39-32-24-18-19-26(31(23-24)29(32)35)28(34)30-38-25-16-13-12-14-17-25/h24-27H,5-23H2,1-4H3/p+1/t24-,26+,27?/m1/s1 |
| InChIKey | QBYRPMIROAHSFH-MFHGLKJTSA-O |
| XLogP | 5.24 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.85 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|