C26H22BrNO3S — CID 141490822
4-acetyl-3-(4-bromophenyl)-1-(10H-phenothiazin-1-yl)hexane-1,5-dione (PubChem CID 141490822) has the molecular formula C26H22BrNO3S and a molecular weight of 508.44 g/mol. Its IUPAC name is 4-acetyl-3-(4-bromophenyl)-1-(10H-phenothiazin-1-yl)hexane-1,5-dione.
| Compound Name | 4-acetyl-3-(4-bromophenyl)-1-(10H-phenothiazin-1-yl)hexane-1,5-dione |
|---|---|
| PubChem CID | 141490822 |
| Molecular Formula | C26H22BrNO3S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | 4-acetyl-3-(4-bromophenyl)-1-(10H-phenothiazin-1-yl)hexane-1,5-dione |
| SMILES | CC(=O)C(C(C)=O)C(CC(=O)c1cccc2c1Nc1ccccc1S2)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H22BrNO3S/c1-15(29)25(16(2)30)20(17-10-12-18(27)13-11-17)14-22(31)19-6-5-9-24-26(19)28-21-7-3-4-8-23(21)32-24/h3-13,20,25,28H,14H2,1-2H3 |
| InChIKey | SNDADUVQXRXFTP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|