C15H21N5O2S — CID 141495053
3-(azidomethyl)-5-tert-butyl-2-(4-methylphenyl)sulfonyl-3,4-dihydropyrazole (PubChem CID 141495053) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-(azidomethyl)-5-tert-butyl-2-(4-methylphenyl)sulfonyl-3,4-dihydropyrazole.
| Compound Name | 3-(azidomethyl)-5-tert-butyl-2-(4-methylphenyl)sulfonyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 141495053 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-(azidomethyl)-5-tert-butyl-2-(4-methylphenyl)sulfonyl-3,4-dihydropyrazole |
| SMILES | Cc1ccc(S(=O)(=O)N2N=C(C(C)(C)C)CC2CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C15H21N5O2S/c1-11-5-7-13(8-6-11)23(21,22)20-12(10-17-19-16)9-14(18-20)15(2,3)4/h5-8,12H,9-10H2,1-4H3 |
| InChIKey | YLMBBKWMNMMXDI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 98.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|