C10H18N2 — CID 141794878
(3aR,4R,7aS)-N,2-dimethyl-1,3,3a,4,7,7a-hexahydroisoindol-4-amine (PubChem CID 141794878) has the molecular formula C10H18N2 and a molecular weight of 166.26 g/mol. Its IUPAC name is (3aR,4R,7aS)-N,2-dimethyl-1,3,3a,4,7,7a-hexahydroisoindol-4-amine.
| Compound Name | (3aR,4R,7aS)-N,2-dimethyl-1,3,3a,4,7,7a-hexahydroisoindol-4-amine |
|---|---|
| PubChem CID | 141794878 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (3aR,4R,7aS)-N,2-dimethyl-1,3,3a,4,7,7a-hexahydroisoindol-4-amine |
| SMILES | CN[C@@H]1C=CC[C@H]2[C@@H]1CN(C2)C |
| InChI | InChI=1S/C10H18N2/c1-11-10-5-3-4-8-6-12(2)7-9(8)10/h3,5,8-11H,4,6-7H2,1-2H3/t8-,9+,10-/m1/s1 |
| InChIKey | STODDSZUXRCZSO-KXUCPTDWSA-N |
| XLogP | 0.80 |
| TPSA | 15.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 188 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|