C15H24N2O2 — CID 142007361
ethane;(2Z)-2-(methylamino)-4-(4-methylcyclohexa-1,3-dien-1-yl)oxypenta-2,4-dienamide (PubChem CID 142007361) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is ethane;(2Z)-2-(methylamino)-4-(4-methylcyclohexa-1,3-dien-1-yl)oxypenta-2,4-dienamide.
| Compound Name | ethane;(2Z)-2-(methylamino)-4-(4-methylcyclohexa-1,3-dien-1-yl)oxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 142007361 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | ethane;(2Z)-2-(methylamino)-4-(4-methylcyclohexa-1,3-dien-1-yl)oxypenta-2,4-dienamide |
| SMILES | C=C(/C=C(\NC)C(N)=O)OC1=CC=C(C)CC1.CC |
| InChI | InChI=1S/C13H18N2O2.C2H6/c1-9-4-6-11(7-5-9)17-10(2)8-12(15-3)13(14)16;1-2/h4,6,8,15H,2,5,7H2,1,3H3,(H2,14,16);1-2H3/b12-8-; |
| InChIKey | UVCZANAXPSRPOA-JCTPKUEWSA-N |
| XLogP | 2.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|