About 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite
1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite (PubChem CID 142037591) has the molecular formula C22H29FS
and a molecular weight of 344.54 g/mol. Its IUPAC name is 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite.
Molecular Properties
| Compound Name | 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite |
| PubChem CID | 142037591 |
| Molecular Formula | C22H29FS |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite |
| SMILES | C=C(c1ccccc1)c1ccc(/C(C)=C\C)c(C)c1.CC.CSF |
| InChI | InChI=1S/C19H20.C2H6.CH3FS/c1-5-14(2)19-12-11-18(13-15(19)3)16(4)17-9-7-6-8-10-17;1-2;1-3-2/h5-13H,4H2,1-3H3;1-2H3;1H3/b14-5-;; |
| InChIKey | MOCHPMGRJWBPNM-VGBRJKJSSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite?
The IUPAC name of 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite (CID 142037591) is 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite.
What is the SMILES notation for 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite?
The canonical SMILES for 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite is C=C(c1ccccc1)c1ccc(/C(C)=C\C)c(C)c1.CC.CSF.
What is the InChIKey of 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite?
The InChIKey is MOCHPMGRJWBPNM-VGBRJKJSSA-N. The full InChI is InChI=1S/C19H20.C2H6.CH3FS/c1-5-14(2)19-12-11-18(13-15(19)3)16(4)17-9-7-6-8-10-17;1-2;1-3-2/h5-13H,4H2,1-3H3;1-2H3;1H3/b14-5-;;.
What are the key properties of 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite?
1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite has a molecular weight of 344.54 g/mol, XLogP of 7.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-but-2-en-2-yl]-2-methyl-4-(1-phenylethenyl)benzene;ethane;methyl thiohypofluorite is sourced from PubChem (CID 142037591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).