C25H38O7 — CID 142038512
methanol;methyl 3-butyl-3-(prop-2-enoyloxymethyl)heptanoate;phthalaldehyde (PubChem CID 142038512) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is methanol;methyl 3-butyl-3-(prop-2-enoyloxymethyl)heptanoate;phthalaldehyde.
| Compound Name | methanol;methyl 3-butyl-3-(prop-2-enoyloxymethyl)heptanoate;phthalaldehyde |
|---|---|
| PubChem CID | 142038512 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | methanol;methyl 3-butyl-3-(prop-2-enoyloxymethyl)heptanoate;phthalaldehyde |
| SMILES | C=CC(=O)OCC(CCCC)(CCCC)CC(=O)OC.CO.O=Cc1ccccc1C=O |
| InChI | InChI=1S/C16H28O4.C8H6O2.CH4O/c1-5-8-10-16(11-9-6-2,12-15(18)19-4)13-20-14(17)7-3;9-5-7-3-1-2-4-8(7)6-10;1-2/h7H,3,5-6,8-13H2,1-2,4H3;1-6H;2H,1H3 |
| InChIKey | IQSVIAVMQOKLOO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|