C22H37NO8 — CID 142059015
ditert-butyl (2R,4R,5R)-4-(acetyloxymethyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrrolidine-1,2-dicarboxylate (PubChem CID 142059015) has the molecular formula C22H37NO8 and a molecular weight of 443.54 g/mol. Its IUPAC name is ditert-butyl (2R,4R,5R)-4-(acetyloxymethyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4R,5R)-4-(acetyloxymethyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142059015 |
| Molecular Formula | C22H37NO8 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | ditert-butyl (2R,4R,5R)-4-(acetyloxymethyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(=O)OC[C@@H]1C[C@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1C1COC(C)(C)O1 |
| InChI | InChI=1S/C22H37NO8/c1-13(24)27-11-14-10-15(18(25)30-20(2,3)4)23(19(26)31-21(5,6)7)17(14)16-12-28-22(8,9)29-16/h14-17H,10-12H2,1-9H3/t14-,15+,16?,17+/m0/s1 |
| InChIKey | CSQBLOWJCLYTKE-RUENRELNSA-N |
| XLogP | 3.04 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|