C11H9F6IO4 — CID 142063977
[phenyl(2,2,2-trifluoroethoxymethoxy)-λ3-iodanyl] 2,2,2-trifluoroacetate (PubChem CID 142063977) has the molecular formula C11H9F6IO4 and a molecular weight of 446.08 g/mol. Its IUPAC name is [phenyl(2,2,2-trifluoroethoxymethoxy)-λ3-iodanyl] 2,2,2-trifluoroacetate.
| Compound Name | [phenyl(2,2,2-trifluoroethoxymethoxy)-λ3-iodanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 142063977 |
| Molecular Formula | C11H9F6IO4 |
| Molecular Weight | 446.08 g/mol |
| Exact Mass | 445.94 |
| IUPAC Name | [phenyl(2,2,2-trifluoroethoxymethoxy)-λ3-iodanyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OI(OCOCC(F)(F)F)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H9F6IO4/c12-10(13,14)6-20-7-21-18(8-4-2-1-3-5-8)22-9(19)11(15,16)17/h1-5H,6-7H2 |
| InChIKey | BQNBILLUJJMHSK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.08 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|